A4829412
2,2,4,4,6,8,8-Heptamethylnonane , >97.0%(GC) , 4390-04-9
Synonym(s):
HMN
CAS NO.:4390-04-9
Empirical Formula: C16H34
Molecular Weight: 226.44
MDL number: MFCD00008856
EINECS: 224-506-8
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB87.20 | In Stock |
|
| 25ML | RMB295.20 | In Stock |
|
| 100ML | RMB972.00 | In Stock |
|
| 500ML | RMB3412.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -3.71°C (estimate) |
| Boiling point: | 240 °C(lit.) |
| Density | 0.793 g/mL at 25 °C(lit.) |
| vapor density | 7.9 (vs air) |
| vapor pressure | <1 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 204 °F |
| form | Liquid |
| Specific Gravity | 0.793 |
| color | Clear colorless |
| Water Solubility | 0.31ug/L(25 ºC) |
| BRN | 1840009 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT SOLVENT |
| InChI | 1S/C16H34/c1-13(10-14(2,3)4)11-16(8,9)12-15(5,6)7/h13H,10-12H2,1-9H3 |
| InChIKey | VCLJODPNBNEBKW-UHFFFAOYSA-N |
| SMILES | CC(CC(C)(C)C)CC(C)(C)CC(C)(C)C |
| LogP | 7.940 (est) |
| Surface tension | 24.1 mN/m at 294K |
| CAS DataBase Reference | 4390-04-9(CAS DataBase Reference) |
| EPA Substance Registry System | Nonane, 2,2,4,4,6,8,8-heptamethyl- (4390-04-9) |
Description and Uses
2,2,4,4,6,8,8-Heptamethylnonane was used to study the effects of loading and aging pyrene in soils. It was also used to study its long term effect on the cell surface hydrophobicity (CSH) of a hexane-degrading Pseudomonas aeruginosa strain and a toluene-degrading Pseudomonas putida strain.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H304 |
| Precautionary statements | P501-P331-P301+P310-P405 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29011000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Asp. Tox. 1 |




