A4831212
2-(2-Hydroxy-5-methylphenyl)benzotriazole , >99.0% , 2440-22-4
Synonym(s):
2-(2H-Benzotriazol-2-yl)-p-cresol;2-(2-Hydroxy-5-methylphenyl)benzotriazole
CAS NO.:2440-22-4
Empirical Formula: C13H11N3O
Molecular Weight: 225.25
MDL number: MFCD00022903
EINECS: 219-470-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB76.00 | In Stock |
|
| 250g | RMB167.20 | In Stock |
|
| 500G | RMB306.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125.5-129.5 °C(lit.) |
| Boiling point: | bp10 225° |
| Density | 1.38 |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.5600 (estimate) |
| Flash point: | 54°C |
| storage temp. | 15-25°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.15±0.43(Predicted) |
| color | Off-White to Pale Yellow |
| Water Solubility | 173μg/L at 20℃ |
| Merck | 14,3447 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | UV ABSORBER |
| Cosmetic Ingredient Review (CIR) | Drometrizole (2440-22-4) |
| InChI | 1S/C13H11N3O/c1-9-6-7-13(17)12(8-9)16-14-10-4-2-3-5-11(10)15-16/h2-8,17H,1H3 |
| InChIKey | MCPKSFINULVDNX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(c1)-n2nc3ccccc3n2 |
| LogP | 4.2 at 25℃ |
| CAS DataBase Reference | 2440-22-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 2-(2H-benzotriazol-2-yl)-4-methyl-(2440-22-4) |
| EPA Substance Registry System | 2-(2H-Benzotriazol-2-yl)-p-cresol (2440-22-4) |
Description and Uses
Drometrizole is an intermediate reactant in the synthesis of UV light absorbers for polyester fibers.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-53-43 |
| Safety Statements | 22-24/25-36/37 |
| WGK Germany | 1 |
| RTECS | GO6860000 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 1 Skin Sens. 1B |
| Toxicity | LD50 oral in mouse: 6500mg/kg |








