A4716612
2-Hydroxy-4-methoxybenzophenone , 99% , 131-57-7
Synonym(s):
2-Hydroxy-4-methoxybenzophenone;Oxybenzone
CAS NO.:131-57-7
Empirical Formula: C14H12O3
Molecular Weight: 228.24
MDL number: MFCD00008387
EINECS: 205-031-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB26.40 | In Stock |
|
| 50g | RMB47.20 | In Stock |
|
| 100G | RMB54.40 | In Stock |
|
| 250g | RMB135.20 | In Stock |
|
| 500G | RMB220.80 | In Stock |
|
| 2.5kg | RMB834.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-64 °C(lit.) |
| Boiling point: | 150-160 °C5 mm Hg(lit.) |
| Density | 1,3 g/cm3 |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | 1.5805 (estimate) |
| Flash point: | 216°C |
| storage temp. | 2-8°C |
| solubility | 95% ethanol: soluble50mg/mL, clear, colorless |
| form | Crystalline Powder |
| pka | 7.56±0.35(Predicted) |
| color | White to light yellow |
| Odor | ylsh. cryst., rose-like odor |
| Water Solubility | <0.1 g/100 mL at 20 ºC |
| Merck | 14,6954 |
| BRN | 1913145 |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | LIGHT STABILIZER UV ABSORBER UV FILTER |
| Cosmetic Ingredient Review (CIR) | UV absorber UV-9 (131-57-7) |
| InChI | 1S/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H3 |
| InChIKey | DXGLGDHPHMLXJC-UHFFFAOYSA-N |
| SMILES | COc1ccc(c(O)c1)C(=O)c2ccccc2 |
| LogP | 3.45 at 40℃ |
| CAS DataBase Reference | 131-57-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Oxybenzone(131-57-7) |
| EPA Substance Registry System | 2-Hydroxy-4-methoxybenzophenone (131-57-7) |
Description and Uses
Oxybenzone is an organic compound used in sunscreens. Oxybenzone is used as an ingredient in sunscreen and other cosmetics because it absorbs UVB and short-wave UVA (ultraviolet) rays. Oxybenzone was one of the first compounds incorporated into sunscreen formulations to offer enhanced UVA protection because its absorption spectrum extends to less than 350 nm.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| RIDADR | UN 3077 9/PG III |
| WGK Germany | 2 |
| RTECS | DJ1575000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29145000 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 |
| Hazardous Substances Data | 131-57-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >12.8 g/kg (Lewerenz) |







