A4841912
Heneicosafluorodecyl Iodide , >97.0%(GC) , 423-62-1
CAS NO.：423-62-1
Empirical Formula: C10F21I
Molecular Weight: 645.98
MDL number: MFCD00001065
EINECS: 207-030-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB60.00 | In Stock |
|
| 5G | RMB198.40 | In Stock |
|
| 25G | RMB559.20 | In Stock |
|
| 100G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-67 °C |
| Boiling point: | 195-200 °C |
| Density | 1.8 |
| refractive index | 1.317 |
| Flash point: | 195-200°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | Off-White |
| Sensitive | Light Sensitive |
| BRN | 1810506 |
| Exposure limits | ACGIH: TWA 0.01 ppm |
| InChI | 1S/C10F21I/c11-1(12,3(15,16)5(19,20)7(23,24)9(27,28)29)2(13,14)4(17,18)6(21,22)8(25,26)10(30,31)32 |
| InChIKey | UDWBMXSQHOHKOI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| CAS DataBase Reference | 423-62-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Perfluorodecyl iodide(423-62-1) |
| EPA Substance Registry System | Decane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heneicosafluoro-10-iodo- (423-62-1) |
Description and Uses
Perfluorodecyl iodide is used to prepare 3,5-bis(perfluorodecyl)phenylboronic acid, "green" catalyst for the direct amide condensation reaction. It is also used to synthesize 3-(perfluorodecyl)prop-1-ene.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| RTECS | MD8710000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29033990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
