A7896312
Tridecafluorohexyl Iodide , >98.0%(GC) , 355-43-1
Synonym(s):
1-Iodoperfluorohexane;1-Iodotridecafluorohexane;Tridecafluoro-1-iodohexane;Tridecafluorohexyl iodide
CAS NO.:355-43-1
Empirical Formula: C6F13I
Molecular Weight: 445.95
MDL number: MFCD00001063
EINECS: 206-586-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB101.60 | In Stock |
|
| 50g | RMB191.20 | In Stock |
|
| 100G | RMB340.80 | In Stock |
|
| 250g | RMB663.20 | In Stock |
|
| 500g | RMB1172.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -45 °C |
| Boiling point: | 117 °C(lit.) |
| Density | 2.063 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 117°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Pale Pink |
| Specific Gravity | 2.063 |
| Water Solubility | insoluble |
| Sensitive | Light Sensitive |
| BRN | 1802118 |
| Stability: | Stable. |
| InChI | 1S/C6F13I/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)20 |
| InChIKey | BULLJMKUVKYZDJ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| CAS DataBase Reference | 355-43-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Perfluorohexyl iodide(355-43-1) |
| EPA Substance Registry System | Hexane, 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-iodo- (355-43-1) |
Description and Uses
Perfluorohexyl Iodide is an important intermediate in the synthesis of organic fluorides products. It also exhibits estrogenic activity in vitro. Perfluorohexyl Iodide is used in the screening assay for binding affinities of perfluoroalkyl iodide for estrogen receptor alpha and beta isoforms.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-37/39-26-37 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| F | 8 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29034700 |
| Storage Class | 10 - Combustible liquids |







