1,1,1,2,2,3,3,4,4-Nonafluoro-6-iodohexane , 98% , 2043-55-2
Synonym(s):
1H,1H,2H,2H-Perfluorohexyl iodide
CAS NO.:2043-55-2
Empirical Formula: C6H4F9I
Molecular Weight: 373.99
MDL number: MFCD00039409
EINECS: 218-055-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB228.80 | In Stock |
|
| 100g | RMB679.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | -25°C |
| Boiling point: | 138 °C |
| Density | 1.94 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 138-140°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Light yellow to Light red |
| Specific Gravity | 1.940 |
| Sensitive | Light Sensitive |
| BRN | 1870862 |
| InChI | 1S/C6H4F9I/c7-3(8,1-2-16)4(9,10)5(11,12)6(13,14)15/h1-2H2 |
| InChIKey | CXHFIVFPHDGZIS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI |
| CAS DataBase Reference | 2043-55-2(CAS DataBase Reference) |
| EPA Substance Registry System | Hexane, 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo- (2043-55-2) |
Description and Uses
1H,1H,2H,2H-Perfluorohexyl iodide is a polyfluorinated iodine alkane (PFI). This compound consists of an even-numbered hydrophobic alkyl chain (typically C4–C12), which is wholly or partially fluorinated and includes an iodine atom at one or both ends. PFIs are reaction products synthesized from the telomerization process by iodine pentafluoride reacting with unsaturated taxogen molecules such as tetrafluoroethylene and ethylene. PFIs are used as critical industrial intermediates for producing various PFCs, such as fluorotelomer alcohols, olefins, and acrylate monomers[1].
1H,1H,2H,2H-Perfluorohexyl iodide has been used for the study for fluorinated phosphonium ionic liquids as a reagent, and in general is used as a reactant in organic reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29037800 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







