A6668212
1H,1H,2H,2H-Perfluorooctyl iodide , 97% , 2043-57-4
Synonym(s):
1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-8-iodooctane;1H,1H,2H,2H-Perfluorooctyl iodide;3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl iodide;8-Iodo-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane
CAS NO.:2043-57-4
Empirical Formula: C8H4F13I
Molecular Weight: 474
MDL number: MFCD00039410
EINECS: 218-056-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB72.80 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| 500g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 21 °C |
| Boiling point: | 92 °C45 mm Hg(lit.) |
| Density | 1.934 g/mL at 25 °C(lit.) |
| vapor pressure | 24-429Pa at 20-50℃ |
| refractive index | n |
| Flash point: | 177 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | Liquid |
| color | Clear |
| Water Solubility | insoluble |
| Sensitive | Light Sensitive |
| BRN | 1887105 |
| Stability: | Volatile |
| InChI | 1S/C8H4F13I/c9-3(10,1-2-22)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1-2H2 |
| InChIKey | CHTNKOVIYUCLTB-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI |
| LogP | 3.8 at 20℃ and pH6.6-7.1 |
| CAS DataBase Reference | 2043-57-4(CAS DataBase Reference) |
| EPA Substance Registry System | Octane, 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodo- (2043-57-4) |
Description and Uses
Perfluorohexylethyl Iodide, is a Polyfluorinated iodine alkanes (PFIs), which are important intermediates in the synthesis of organic fluoride products. It has also been shown to have potential estrogenic effects.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 8 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| HazardClass | IRRITANT-HARMFUL |
| HS Code | 29037790 |
| Storage Class | 10 - Combustible liquids |







