A4754512
Heptadecafluoro-1-iodooctane , 98% , 507-63-1
Synonym(s):
1-Iodoperfluorooctane;Heptadecafluorooctyl iodide;Perfluorooctyl iodide
CAS NO.:507-63-1
Empirical Formula: C8F17I
Molecular Weight: 545.96
MDL number: MFCD00001064
EINECS: 208-079-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 10g | RMB71.20 | In Stock |
|
| 25G | RMB132.00 | In Stock |
|
| 50g | RMB239.20 | In Stock |
|
| 100G | RMB452.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25 °C |
| Boiling point: | 160-161 °C(lit.) |
| Density | 2.067 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 160-161°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid After Melting |
| color | Clear colorless to yellow or light pink |
| Sensitive | Light Sensitive |
| BRN | 1717141 |
| Exposure limits | ACGIH: TWA 0.01 ppm |
| InChI | 1S/C8F17I/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26 |
| InChIKey | KWXGJTSJUKTDQU-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| CAS DataBase Reference | 507-63-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Perfluorooctyl iodide(507-63-1) |
| EPA Substance Registry System | Octane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-8-iodo- (507-63-1) |
Description and Uses
Heptadecafluoro-1-iodooctane has been used as monodentate donor to investigate anion receptor complexes of mono-, bi- and tridentate donors with a variety of anions in the gas phase using both experimental and theoretical approaches.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 2922 |
| WGK Germany | 3 |
| RTECS | RG9700050 |
| F | 8 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29037800 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 ivn-mus: 7500 mg/kg MIVRA6 8,320,74 |







