A7786912
3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl acrylate , 97%, containing stabilizer mehq , 17527-29-6
Synonym(s):
1H,1H,2H,2H-perfluorooctyl acrylate;TFOA
CAS NO.:17527-29-6
Empirical Formula: C11H7F13O2
Molecular Weight: 418.15
MDL number: MFCD00042351
EINECS: 241-527-8
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB72.00 | In Stock |
|
| 25ML | RMB230.40 | In Stock |
|
| 100ml | RMB640.00 | In Stock |
|
| 500ml | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 76-80 °C8 mm Hg(lit.) |
| Density | 1.554 g/mL at 25 °C(lit.) |
| vapor pressure | 2.59hPa at 25℃ |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate, Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Specific Gravity | 1.554 |
| Water Solubility | 185μg/L at 25℃ |
| Stability: | Light Sensitive |
| InChI | 1S/C11H7F13O2/c1-2-5(25)26-4-3-6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h2H,1,3-4H2 |
| InChIKey | VPKQPPJQTZJZDB-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOC(=O)C=C |
| LogP | 5.067 at 25℃ |
| CAS DataBase Reference | 17527-29-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,1,2,2-Tetrahydroperfluorooctyl acrylate (17527-29-6) |
Description and Uses
1H,1H,2H,2H-Perfluorooctyl Acrylate is a semi-volatile fluorinated organic compound found in spring-time polluted Asian and western US air masses.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Liver,Teeth |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29037800 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 1 STOT RE 2 |







