A4862912
2-<WBR>(2-<WBR>Hydroxyphenyl)<WBR>-<WBR>1<I>H</I>-benzimidazole , 95% , 2963-66-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB143.20 | In Stock |
|
| 5G | RMB400.00 | In Stock |
|
| 25g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239-243 °C |
| Boiling point: | 444.2±47.0 °C(Predicted) |
| Density | 1.323±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | Solubility Insoluble in water; soluble in ethanol |
| pka | 9.23(at 25℃) |
| form | crystals |
| color | White to tan |
| PH Range | Non0 uorescence (<9.9) to blue-violet 0 uorescence (9.9) |
| λmax | 245nm, 300nm |
| Major Application | Optical devices, photography, plastic scintillation applications, fungicide, antiviral agent, antiinflammatory agent, antibacterial agent |
| InChI | 1S/C13H10N2O/c16-12-8-4-1-5-9(12)13-14-10-6-2-3-7-11(10)15-13/h1-8,16H,(H,14,15) |
| InChIKey | XWXMGTIHBYFTIE-UHFFFAOYSA-N |
| SMILES | Oc1ccccc1-c2nc3ccccc3[nH]2 |
| EPA Substance Registry System | Phenol, 2-(1H-benzimidazol-2-yl)- (2963-66-8) |
Description and Uses
2-(2-Hydroxyphenyl)-1H-benzimidazole is a chemical reagent used in pharmaceutical syntheses. Used in the synthesis of selective inhibitors of PI3Kα against human tumor cell lines.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







![2-(1H-Benzo[d]imidazol-2-yl)-4-bromophenol](https://img.chemicalbook.com/CAS/GIF/62871-28-7.gif)