A4865712
2,2,3,3,4,4,4-<WBR>Heptafluorobutyl acrylate , 97% , 424-64-6
Synonym(s):
HFBA
CAS NO.:424-64-6
Empirical Formula: C7H5F7O2
Molecular Weight: 254.1
MDL number: MFCD00039252
EINECS: 207-036-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB263.20 | In Stock |
|
| 25G | RMB911.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 120-122 °C/743 mmHg (lit.) |
| Density | 1.418 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 88 °F |
| storage temp. | Flammables area |
| form | Liquid |
| Specific Gravity | 1.485 |
| color | Clear colorless to slightly yellow |
| Water Solubility | Not miscible in water. |
| Sensitive | Lachrymatory |
| BRN | 1792520 |
| InChI | InChI=1S/C7H5F7O2/c1-2-4(15)16-3-5(8,9)6(10,11)7(12,13)14/h2H,1,3H2 |
| InChIKey | PLXOUIVCSUBZIX-UHFFFAOYSA-N |
| SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)F)(=O)C=C |
| CAS DataBase Reference | 424-64-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2,2,3,3,4,4,4-Heptafluorobutyl acrylate (424-64-6) |
Description and Uses
2,2,3,3,4,4,4-Heptafluorobutyl acrylate is a useful fluorinated acrylate for proteomics research. It is also used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302+H312+H332-H319-H335 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 10-20/21/22-36/37 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Lachrymatory |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29161210 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 STOT SE 3 |







