A4908812
1H,1H,2H,2H-Perfluorodecylamine , 98% , 30670-30-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB306.72 | In Stock |
|
| 1G | RMB580.00 | In Stock |
|
| 5G | RMB2465.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 73 °C |
| Density | 1.595±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Ethanol (Slightly), Methanol (Slightly) |
| pka | 8.56±0.10(Predicted) |
| form | Oil |
| color | Clear Colourless |
| InChI | InChI=1S/C10H6F17N/c11-3(12,1-2-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h1-2,28H2 |
| InChIKey | PFINVJYJNJHTFY-UHFFFAOYSA-N |
| SMILES | C(N)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| EPA Substance Registry System | 1H,1H,2H,2H-Perfluorodecylamine (30670-30-5) |
Description and Uses
1H,1H,2H,2H-Perfluorodecylamine can be used as self-assembled monolayer (SAM) in organic LEDs
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P310+P330+P331-P303+P361+P353+P310-P304+P340+P310-P305+P351+P338+P310-P363-P405 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
