A4942412
2-Hydroxy-4-(methylthio)butyric Acid , ≥85%(NT) , 583-91-5
CAS NO.:583-91-5
Empirical Formula: C5H10O3S
Molecular Weight: 150.2
MDL number: MFCD00070490
EINECS: 209-523-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB159.20 | In Stock |
|
| 5G | RMB399.20 | In Stock |
|
| 25G | RMB959.20 | In Stock |
|
| 100G | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 74°C |
| Density | 1.277±0.06 g/cm3 | Condition: Temp: 20 °C Press: 760 Torr |
| refractive index | 1.5151 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in DMSO:0.0(Max Conc. mg/mL);0.0(Max Conc. mM) |
| pka | 3.67±0.10(Predicted) |
| form | Liquid
(Density: 1.22 g/cm3) |
| color | Light yellow to brown |
| optical activity | 0.7° (C=0.15 g/100ml, ETOH) |
| Merck | 14,5976 |
| InChI | InChI=1S/C5H10O3S/c1-9-3-2-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8) |
| InChIKey | ONFOSYPQQXJWGS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(O)CCSC |
| CAS DataBase Reference | 583-91-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Hydroxy-4-(methylthio) butanoic acid (583-91-5) |
Description and Uses
Methionine hydroxy analogue
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H318-H412 |
| Precautionary statements | P273-P501-P264-P280-P302+P352-P321-P332+P313-P362-P280-P305+P351+P338-P310 |
| Risk Statements | 23/24/25 |
| Safety Statements | 26-36/37/39-45 |
| RTECS | ET4731500 |
| HS Code | 2930.90.4600 |
| Hazardous Substances Data | 583-91-5(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 3478mg/kg |




