A4944012
3-(3-Hydroxyphenyl)propanoic acid , 98% , 621-54-5
Synonym(s):
3-(3-Hydroxyphenyl)propanoic acid;NSC 33135;NSC 39468
CAS NO.：621-54-5
Empirical Formula: C9H10O3
Molecular Weight: 166.17
MDL number: MFCD00016554
EINECS: 210-692-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB28.80 | In Stock |
|
| 1G | RMB68.00 | In Stock |
|
| 5g | RMB209.60 | In Stock |
|
| 10g | RMB412.48 | In Stock |
|
| 25g | RMB726.40 | In Stock |
|
| 100g | RMB1910.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111 °C |
| Boiling point: | 355℃ |
| Density | 1.260 |
| Flash point: | 182℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform and methanol. |
| pka | 4.68±0.10(Predicted) |
| form | Solid |
| color | Pale Beige to Light Brown |
| BRN | 1947445 |
| InChI | InChI=1S/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
| InChIKey | QVWAEZJXDYOKEH-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=CC(O)=C1 |
| CAS DataBase Reference | 621-54-5(CAS DataBase Reference) |
Description and Uses
3-Hydroxyphenylpropionic acid acts as a urinary metabolite of procyanidins in pigs. It also serves as an intermediate in the preparation of various synthetic organic products. Further, it is used in the preparation of 3-(3-hydroxy-phenyl)-propionic acid methyl ester.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H303-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RTECS | MW5340000 |
| HS Code | 29163990 |
