A4975612
Indole-5-carboxylic Acid , 98% , 1670-81-1
Synonym(s):
5-Carboxyindole
CAS NO.:1670-81-1
Empirical Formula: C9H7NO2
Molecular Weight: 161.16
MDL number: MFCD00005678
EINECS: 216-799-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB45.60 | In Stock |
|
| 5G | RMB145.60 | In Stock |
|
| 25G | RMB660.80 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-213 °C (lit.) |
| Boiling point: | 287.44°C (rough estimate) |
| Density | 1.2480 (rough estimate) |
| refractive index | 1.5050 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in ethanol (50 mg/ml), dimethyl sulfoxide and methanol. |
| pka | 4.40±0.30(Predicted) |
| form | Powder |
| color | Light beige to yellow |
| BRN | 124391 |
| InChI | InChI=1S/C9H7NO2/c11-9(12)7-1-2-8-6(5-7)3-4-10-8/h1-5,10H,(H,11,12) |
| InChIKey | IENZCGNHSIMFJE-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(C(O)=O)C=C2)C=C1 |
| CAS DataBase Reference | 1670-81-1(CAS DataBase Reference) |
Description and Uses
Indole-5-carboxylic acid is the suitable reagent used to study the intramolecular excited state proton transfer in indole-2-carboxylic acid and indole-5-carboxylic acid in various solvents in acidic, basic, and neutral media by steady state and time resolved fluorescence spectroscopy. It may be used in the electrochemical synthesis of poly(indole-5-carboxylic acid) (PICA) films.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-21/22 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339990 |




