Iodonitrotetrazolium chloride , 98% , 146-68-9
Synonym(s):
p-Iodonitrotetrazolium Violet;2-(4-Iodophenyl)-3-(4-nitrophenyl)-5-phenyl-2H-tetrazolium chloride;INT
CAS NO.:146-68-9
Empirical Formula: C19H13ClIN5O2
Molecular Weight: 505.7
MDL number: MFCD00011961
EINECS: 205-676-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB102.40 | In Stock |
|
| 1G | RMB198.40 | In Stock |
|
| 5G | RMB773.60 | In Stock |
|
| 25G | RMB3799.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 240 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | methanol: water (1:1): 50 mg/mL hot, very faintly turbid, very deep yellow |
| form | Powder, Crystals and/or Chunks |
| color | White to off-white |
| Appearance | Yellow powder |
| Water Solubility | soluble |
| Sensitive | Light Sensitive |
| λmax | 248nm |
| BRN | 4093224 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Biological Applications | Bacterial vaginosis diagnosis assay; dehydrogenase enzyme assay; diagnostic assay; food and beverage analytes assays; microbial growth assay; detecting bacteria,yeast,fungi,gamma-hydroxybutyric acid (GHB),microbial growth; measuring niacin,bacterial respiratory activity,superoxide dismutase;treating cancer |
| InChI | InChI=1S/C19H13IN5O2.ClH/c20-15-6-8-16(9-7-15)23-21-19(14-4-2-1-3-5-14)22-24(23)17-10-12-18(13-11-17)25(26)27;/h1-13H;1H/q+1;/p-1 |
| InChIKey | JORABGDXCIBAFL-UHFFFAOYSA-M |
| SMILES | [N+]1(=NC(C2C=CC=CC=2)=NN1C1C=CC(I)=CC=1)C1=CC=C([N+]([O-])=O)C=C1.[Cl-] |
| CAS DataBase Reference | 146-68-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Tetrazolium, 2-(4-iodophenyl)-3-(4-nitrophenyl)-5-phenyl-, chloride (146-68-9) |
Description and Uses
Iodonitrotetrazolium (INT) (chloride) is a monotetrazolium salt used as an indicator dye. It is reduced to an insoluble formazan that is used as a vital dye or indicator of cellular redox activity. Reduction commonly results from the activity of dehydrogenases, although non-
Iodonitrotetrazolium chloride (INT) on reduction gets converted to iodonitrotetrazolium formazan, a water insoluble violet colored dye or indicator. Hence INT can be used for the colorimetric assay of various dehydrogenases.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H335 |
| Precautionary statements | P210-P240-P241-P261-P271-P280 |
| target organs | Eyes,Central nervous system, Respiratory system |
| Hazard Codes | Xn,F,Xi |
| Risk Statements | 20/21/22-68/20/21/22-36/37/38-11 |
| Safety Statements | 36/37-36/37/39-26-22-16 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 3-8-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 1 STOT SE 2 STOT SE 3 |





