A4990512
Indoxyl acetate , 97% , 608-08-2
Synonym(s):
3-Acetoxyindole;3-Indolyl acetate;Acetic acid 3-indolyl ester, 3-Acetoxyindole, Indoxyl acetate
CAS NO.：608-08-2
Empirical Formula: C10H9NO2
Molecular Weight: 175.18
MDL number: MFCD00014561
EINECS: 210-154-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB232.80 | In Stock |
|
| 5G | RMB692.00 | In Stock |
|
| 25g | RMB3119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-130 °C(lit.) |
| Boiling point: | 306.47°C (rough estimate) |
| Density | 1.1999 (rough estimate) |
| refractive index | 1.5060 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Glistening Crystals |
| pka | 15.89±0.30(Predicted) |
| color | Colorless to lilac |
| Water Solubility | Soluble in ethanol, water, chloroform, dichloromethane and methanol. |
| BRN | 143086 |
| InChI | InChI=1S/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
| InChIKey | JBOPQACSHPPKEP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(OC(=O)C)=C1 |
| CAS DataBase Reference | 608-08-2(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Indoxyl acetate (608-08-2) |
Description and Uses
INDOXYL ACETATE is a useful synthetic intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | AI3325000 |
| F | 8-10-21 |
| TSCA | Yes |
| HS Code | 2933 99 80 |
