A5000712
Isoliquiritigenin , Analysis standard , 961-29-5
Synonym(s):
(E)-1-(2,4-Dihydroxyphenyl)-3-(4-hydroxyphenyl)-2-propen-1-one;4,2′,4′-Trihydroxychalcone
CAS NO.:961-29-5
Empirical Formula: C15H12O4
Molecular Weight: 256.25
MDL number: MFCD00075907
EINECS: 607-884-2
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB151.20 | In Stock |
|
| 20mg | RMB193.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 206-210°C |
| Boiling point: | 504.0±42.0 °C(Predicted) |
| Density | 1.384±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | H2O: <0.1 mg/mL |
| pka | 7.50±0.35(Predicted) |
| form | powder |
| color | yellow to orange |
| Water Solubility | H2O: <0.1mg/mL methanol: 10mg/mL DMSO: 20mg/mL |
| Sensitive | Light Sensitive & Hygroscopic |
| BRN | 1914296 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT |
| InChI | InChI=1S/C15H12O4/c16-11-4-1-10(2-5-11)3-8-14(18)13-7-6-12(17)9-15(13)19/h1-9,16-17,19H/b8-3+ |
| InChIKey | DXDRHHKMWQZJHT-FPYGCLRLSA-N |
| SMILES | C(C1=CC=C(O)C=C1O)(=O)/C=C/C1=CC=C(O)C=C1 |
| LogP | 3.110 (est) |
| CAS DataBase Reference | 961-29-5(CAS DataBase Reference) |
Description and Uses
aldose reductase inhibitor, antineoplastic, antiinflammatory
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| WGK Germany | 3 |
| RTECS | FL7080000 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |





