A5001812
4-Iodo-2-methylaniline , 98% , 13194-68-8
CAS NO.:13194-68-8
Empirical Formula: C7H8IN
Molecular Weight: 233.05
MDL number: MFCD00025299
EINECS: 236-154-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB44.64 | In Stock |
|
| 25G | RMB154.40 | In Stock |
|
| 100G | RMB589.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-89 °C (lit.) |
| Boiling point: | 278.4±28.0 °C(Predicted) |
| Density | 1.791±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.66±0.10(Predicted) |
| color | Purple to Dark purple to Dark red |
| Sensitive | Light Sensitive |
| BRN | 2353618 |
| InChI | InChI=1S/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| InChIKey | BGKLFAQCHHCZRZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(I)C=C1C |
| CAS DataBase Reference | 13194-68-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335-H331 |
| Precautionary statements | P304+P340-P405-P501a-P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-26,36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |








