A8415712
4-Iodo-2-nitroaniline , 97% , 20691-72-9
Synonym(s):
4-Iodo-2-nitrophenylamine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB125.60 | In Stock |
|
| 25G | RMB601.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-123 °C (lit.) |
| Boiling point: | 352.9±27.0 °C(Predicted) |
| Density | 2.101±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -1.19±0.10(Predicted) |
| color | Dark Red to Dark Brown |
| Stability: | Air Sensitive |
| InChI | InChI=1S/C6H5IN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| InChIKey | QVCRSYXVWPPBFJ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(I)C=C1[N+]([O-])=O |
Description and Uses
4-Iodo-2-nitroaniline can be used in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-43 |
| Safety Statements | 36/37 |
| WGK Germany | 2 |
| HS Code | 2921490090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |




