A5004357
Dehydrocorydalin , 98% , 30045-16-0
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB319.20 | In Stock |
|
| 5mg | RMB799.20 | In Stock |
|
| 25mg | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-173℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Cryst. |
| color | Light yellow to yellow |
| Stability: | Hygroscopic |
| InChI | 1S/C22H24NO4/c1-13-15-6-7-18(24-2)22(27-5)17(15)12-23-9-8-14-10-19(25-3)20(26-4)11-16(14)21(13)23/h6-7,10-12H,8-9H2,1-5H3/q+1 |
| InChIKey | RFKQJTRWODZPHF-UHFFFAOYSA-N |
| SMILES | CC1=C2[N+](CCC3=C2C=C(OC)C(OC)=C3)=CC4=C(OC)C(OC)=CC=C41 |
Description and Uses
Dehydrocordine has analgesic and sedative effects. It was used for content determination/identification/pharmacological experiments, etc.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS02 |
| Signal word | Danger |
| Hazard statements | H304-H225 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P280-P370+P378-P331-P303+P361+P353-P301+P310-P403+P235-P405 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |






![2-[2-(Methylamino)benzoyl]-3,4-dihydro-β-carboline-1(2H)-one](https://img.chemicalbook.com/CAS/20150408/GIF/526-43-2.gif)

