A5006712
Imazalil solution , analyticalstandard,100ug/mlinmethanol , 35554-44-0
Synonym(s):
1-[2-(Allyloxy)-2-(2,4-dichlorophenyl)ethyl]imidazole;Imazalil
CAS NO.：35554-44-0
Empirical Formula: C14H14Cl2N2O
Molecular Weight: 297.18
MDL number: MFCD00055331
EINECS: 252-615-0
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52.7°C |
| Boiling point: | >340°C |
| Density | 1.348 |
| vapor pressure | 1.58 x l0-4 Pa (20 °C) |
| refractive index | 1.5680 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform: Slightly Soluble; Methanol: Slightly Soluble |
| pka | 6.53 (weak base) |
| form | Solid |
| color | Light yellow to yellow |
| Water Solubility | 0.018 g/100 mL |
| Merck | 13,3616 |
| BRN | 545683 |
| Henry's Law Constant | 3.8×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture environmental |
| InChI | 1S/C14H14Cl2N2O/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16/h2-6,8,10,14H,1,7,9H2 |
| InChIKey | PZBPKYOVPCNPJY-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(Cn2ccnc2)OCC=C)c(Cl)c1 |
| LogP | 3.820 |
| CAS DataBase Reference | 35554-44-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Imazalil(35554-44-0) |
| EPA Substance Registry System | Imazalil (35554-44-0) |
Description and Uses
antifungal
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H318-H332-H410 |
| Precautionary statements | P261-P273-P280-P301+P310-P304+P340+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 20/22-41-50/53 |
| Safety Statements | 26-39-60-61 |
| RIDADR | 2588 |
| WGK Germany | 3 |
| RTECS | NI4776000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Inhalation Aquatic Chronic 1 Carc. 2 Eye Dam. 1 |
| Hazardous Substances Data | 35554-44-0(Hazardous Substances Data) |
