A5010912
Beta-Ionone , 97% , 14901-07-6
CAS NO.:14901-07-6
Empirical Formula: C13H20O
Molecular Weight: 192.3
MDL number: MFCD00001549
EINECS: 238-969-9
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB40.00 | In Stock |
|
| 100ML | RMB115.20 | In Stock |
|
| 500ML | RMB371.20 | In Stock |
|
| 2.5l | RMB1487.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -49°C |
| Boiling point: | 126-128 °C12 mm Hg(lit.) |
| Density | 0.945 g/mL at 25 °C(lit.) |
| vapor pressure | 1.706Pa at 25℃ |
| refractive index | n |
| FEMA | 2595 | BETA-IONONE |
| Flash point: | 230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 0[at 20 ℃] |
| form | Liquid |
| color | Clear slightly yellow to yellow |
| Odor | at 10.00 % in dipropylene glycol. floral woody sweet fruity berry tropical beeswax |
| Odor Type | floral |
| biological source | synthetic |
| Water Solubility | SLIGHTLY SOLUBLE |
| Merck | 14,5056 |
| JECFA Number | 389 |
| BRN | 1909544 |
| Dielectric constant | 12.0(20℃) |
| Stability: | Light Sensitive |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING FRAGRANCE |
| InChI | 1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8H,5-6,9H2,1-4H3/b8-7+ |
| InChIKey | PSQYTAPXSHCGMF-BQYQJAHWSA-N |
| SMILES | CC(=O)\C=C\C1=C(C)CCCC1(C)C |
| LogP | 1.903 at 27℃ |
| CAS DataBase Reference | 14901-07-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(2,6,6-Trimethylcyclohex-1-en-1-yl)but-3-en-2-one(14901-07-6) |
| EPA Substance Registry System | 4-(2,6,6-Trimethyl-1-cyclohexenyl)-3-buten-2-one (14901-07-6) |
Description and Uses
β-Ionone has a characteristic violet-like odor, more fruity and woody than α-ionone. May be prepared by condensing citral with acetone to form pseudoionone, which is then cyclized by acid-type reagents.
beta-Lonone is an essential oil extract from the leaves and flowers of Succisa Pratensis that shows antioxidant and antimicrobial activities against bacteria.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H411 |
| Precautionary statements | P273-P302+P352 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,N |
| Risk Statements | 38-51/53-36/37/38 |
| Safety Statements | 61-36/37/39-27-26-24/25 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | EN0500000 |
| TSCA | TSCA listed |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Skin Irrit. 2 |
| Hazardous Substances Data | 14901-07-6(Hazardous Substances Data) |




