A5017212
Isopropylboronic Acid (contains varying amounts of Anhydride) , 97% , 80041-89-0
Synonym(s):
(1-Methylethyl)boronic acid;(Propan-2-yl)boronic acid;2-Propaneboronic acid
CAS NO.：80041-89-0
Empirical Formula: C3H9BO2
Molecular Weight: 87.91
MDL number: MFCD01319021
EINECS: 676-846-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB367.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-100 °C (lit.) |
| Boiling point: | 160.4±23.0 °C(Predicted) |
| Density | 0.921±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | 10.49±0.43(Predicted) |
| form | Flakes |
| color | White |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 1731883 |
| InChI | InChI=1S/C3H9BO2/c1-3(2)4(5)6/h3,5-6H,1-2H3 |
| InChIKey | QIPHSSYCQCBJAX-UHFFFAOYSA-N |
| SMILES | B(C(C)C)(O)O |
| CAS DataBase Reference | 80041-89-0(CAS DataBase Reference) |
Description and Uses
Isopropylboronic acid as a reagent is involved in copper-promoted cross-coupling, Domino Heck-Suzuki reactions, Suzuki-Miyaura type couple reactions and alkylation-hydride reduction sequence.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29163990 |
