BD4608541
3-(2-Methoxyethoxy)propanoicacid , 95% , 149577-05-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB391.20 | In Stock |
|
| 250mg | RMB688.80 | In Stock |
|
| 1g | RMB1713.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 244.2±20.0 °C(Predicted) |
| Density | 1.098±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.28±0.10(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| InChI | InChI=1S/C6H12O4/c1-9-4-5-10-3-2-6(7)8/h2-5H2,1H3,(H,7,8) |
| InChIKey | KWMXBFIAGYXCCC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCOCCOC |
Description and Uses
m-PEG2-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media.
m-PEG2-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H335-H315 |
| Precautionary statements | P280-P305+P351+P338-P310-P264-P280-P302+P352-P321-P332+P313-P362 |








