A5019412
Isobutylmagnesium Bromide , 1.0MinTHF , 926-62-5
Synonym(s):
iBuMgBr solution
| Pack Size | Price | Stock | Quantity |
| 100ML | RMB110.40 | In Stock |
|
| 500ML | RMB359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-53℃ |
| Boiling point: | 122-123℃ (0.2 Torr) |
| Density | 0.941 g/mL at 25 °C |
| Flash point: | <−30 °F |
| form | liquid |
| InChI | InChI=1S/C4H9.BrH.Mg/c1-4(2)3;;/h4H,1H2,2-3H3;1H;/q;;+1/p-1 |
| InChIKey | CMWBEISSZHZIMU-UHFFFAOYSA-M |
| SMILES | C([Mg]Br)C(C)C |
| CAS DataBase Reference | 926-62-5 |
Description and Uses
Isobutylmagnesium bromide (iBuMgBr) is a general Grignard reagent used in the total synthesis of (+)-rishirilide B, glucolipsin A, and (+)-juvabione. It can also be used as a reagent in the synthesis of pyrrolidine-based influenza neuraminidase (NA) inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H224-H302-H315-H318-H336 |
| Precautionary statements | P210-P261-P280-P305+P351+P338 |
| target organs | Central nervous system |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | F+,C,Xn |
| Risk Statements | 12-14/15-19-22-34-67-66 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HazardClass | 4.2 |
| PackingGroup | I |
| HS Code | 29319090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 1 Skin Irrit. 2 STOT SE 3 |






