A5043512
<I>N</I><SUB>α</SUB>-Fmoc-<I>N</I><SUB>ε</SUB>-biotinyl-<SC>L</SC>-lysine , ≥95%(HPLC) , 146987-10-2
Synonym(s):
Nα-Biotinyl-Nε-Fmoc-L -lysine;Fmoc-Lys(biotin)-OH;Fmoc-Lys(biotinyl)-OH;N-α-Fmoc-N-ε-biotinyl-L-lysine
CAS NO.：146987-10-2
Empirical Formula: C31H38N4O6S
Molecular Weight: 594.72
MDL number: MFCD00270741
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB280.80 | In Stock |
|
| 1G | RMB782.40 | In Stock |
|
| 5G | RMB2287.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-180 °C(Solv: methanol (67-56-1); N,N-dimethylformamide (68-12-2)) |
| Boiling point: | 936.2±65.0 °C(Predicted) |
| Density | 1.271±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly, Heated) |
| pka | 3.88±0.21(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | 18.6°(C=0.01g/mL, DMSO, 20°C, 589nm) |
| Water Solubility | Slightly soluble in water and dimethyl sulfoxide. |
| InChIKey | OFIBQNGDYNGUEZ-OBXRUURASA-N |
| SMILES | C(O)(=O)[C@H](CCCCNC(=O)CCCC[C@H]1[C@@]2([H])NC(=O)N[C@@]2([H])CS1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 146987-10-2(CAS DataBase Reference) |
Description and Uses
Nα-Fmoc-Nε-biotinyl-L-lysine is useful in the synthesis of site-specific biotinylated probes.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H313-H315-H319 |
| Precautionary statements | P210-P240-P241-P242-P243-P261-P264-P271-P280-P303+P361+P353-P304+P340-P305+P351+P338-P312-P363-P370+P378-P403+P233-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2934 99 90 |
