PRODUCT Properties
| Melting point: | ~245 °C (dec.) (lit.) |
| alpha | D25 +53° (c = 1.05 in 0.1N NaOH) |
| Boiling point: | 748.0±60.0 °C(Predicted) |
| Density | 1.234 |
| storage temp. | -20°C |
| solubility | Aqueous Base (Slightly), Water (Slightly, Sonicated) |
| form | Solid |
| pka | 2.53±0.24(Predicted) |
| color | White to Off-White |
| Appearance | White to off-white powder |
| optical activity | [α]20/D +53°, c = 1.05% in 0.1 M NaOH(lit.) |
| Water Solubility | Soluble in water (50 mM) |
| Merck | 13,1227 |
| BRN | 97197 |
| InChIKey | BAQMYDQNMFBZNA-MNXVOIDGSA-N |
| SMILES | C(O)(=O)[C@H](CCCCNC(=O)CCCC[C@H]1[C@@]2([H])NC(=O)N[C@@]2([H])CS1)N |
Description and Uses
Biocytin is a conjugate of biotin and lysine known formally as ε-N-(d-biotinyl)-L-lysine. The addition of lysine to biotin increases the chain length extending from biotin, allowing the synthesis of medium-chain reagents. It also provides terminal carboxyl and amino groups for derivatization or conjugation to proteins and other molecules. Covalent linking reactions typically involve carbodiimide or NHS-ester crosslinking chemistries. Biocytin is also used as an anterograde, retrograde, or intracellular neuroanatomical tracer that is fixable with aldehyde-based fixatives. For this and other applications, biocytin is detected with avidin or streptavidin probes.
Biocytin is used as a substrate to study the specificity and kinetics of biotinidase(s), to measure biotinidase deficiency and as a model compound to study various uptake mechanisms of cells and tissues. Biocytin has been used to label neurons, medium spiny neurons and optic nerves.
Safety
| WGK Germany | 3 |
| HS Code | 29362900 |
