A5044412
<I>N</I>-Boc-<SC>L</SC>-cyclohexylglycinol , 98% , 107202-39-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB240.00 | In Stock |
|
| 5G | RMB997.60 | In Stock |
|
| 10g | RMB1764.00 | In Stock |
|
| 25g | RMB3596.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-87 °C(lit.) |
| Boiling point: | 371.2±25.0 °C(Predicted) |
| Density | 1.037 |
| storage temp. | Sealed in dry,2-8°C |
| pka | 12.07±0.46(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D -13°, c = 1% in chloroform |
| Major Application | peptide synthesis |
| InChI | 1S/C13H25NO3/c1-13(2,3)17-12(16)14-11(9-15)10-7-5-4-6-8-10/h10-11,15H,4-9H2,1-3H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | YNBRORWNNGUYQA-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)C1CCCCC1 |
| CAS DataBase Reference | 107202-39-1 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2906190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
