BD8792031
H-Chg-OMe.HCl , 95% , 14328-63-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB78.40 | In Stock |
|
| 5g | RMB193.60 | In Stock |
|
| 10g | RMB276.00 | In Stock |
|
| 25g | RMB512.80 | In Stock |
|
| 100g | RMB1356.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-189℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C9H17NO2.ClH/c1-12-9(11)8(10)7-5-3-2-4-6-7;/h7-8H,2-6,10H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | ORJOGDRCFDWIIJ-QRPNPIFTSA-N |
| SMILES | C1(CCCCC1)[C@H](N)C(=O)OC.Cl |
Description and Uses
(S)-Methyl 2-amino-2-cyclohexylacetate Hydrochloride is an intermediate used in the synthesis of telaprevir and other pharmaceutical excipients.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |







