A5286412
L-tert-Leucine methyl ester hydrochloride , ≥99.0% , 63038-27-7
CAS NO.:63038-27-7
Empirical Formula: C7H16ClNO2
Molecular Weight: 181.66
MDL number: MFCD00040604
EINECS: 613-136-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB50.40 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-186 °C |
| refractive index | 16.5 ° (C=1, MeOH) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White |
| optical activity | [α]20/D +17.5±1°, c = 1% in methanol |
| BRN | 4879785 |
| Major Application | cell analysis peptide synthesis |
| InChI | InChI=1/C7H15NO2.ClH/c1-7(2,3)5(8)6(9)10-4;/h5H,8H2,1-4H3;1H/t5-;/s3 |
| InChIKey | HRTQWUHFSXVRPY-USHJBNIQNA-N |
| SMILES | [C@@H](N)(C(=O)OC)C(C)(C)C.Cl |&1:0,r| |
| CAS DataBase Reference | 63038-27-7(CAS DataBase Reference) |
Description and Uses
L-tert-Leucine Methyl Ester Hydrochloride is used in the preparation of peptidomimetic protease inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |







