A7753612
(S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid , 97% , 74163-81-8
CAS NO.:74163-81-8
Empirical Formula: C10H11NO2
Molecular Weight: 177.2
MDL number: MFCD00800357
EINECS: 616-058-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB70.40 | In Stock |
|
| 100G | RMB253.60 | In Stock |
|
| 500g | RMB1016.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 309.12°C (rough estimate) |
| alpha | -157.4 º (24 ºC) |
| Density | 1.1607 (rough estimate) |
| refractive index | -166 ° (C=1, 1mol/L NaOH) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | soluble in Hot Water, Basic Water |
| pka | 2.21±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 168°, c = 1.8 in 1.4 M NaOH |
| BRN | 4842199 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H11NO2/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9/h1-4,9,11H,5-6H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | BWKMGYQJPOAASG-VIFPVBQESA-N |
| SMILES | OC(=O)[C@@H]1Cc2ccccc2CN1 |
| CAS DataBase Reference | 74163-81-8(CAS DataBase Reference) |
Description and Uses
(S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic Acid (Quinapril EP Impurity A) is a Quinapril intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







