BD0344232
(S)-Methyl 2-amino-3-cyclohexylpropanoate hydrochloride , 97% , 17193-39-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB80.80 | In Stock |
|
| 10g | RMB156.80 | In Stock |
|
| 25g | RMB311.20 | In Stock |
|
| 100g | RMB1161.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Solid |
| color | White to off-white |
| optical activity | 20.8°(C=0.01g/ml MEOH) |
| InChI | InChI=1/C10H19NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h8-9H,2-7,11H2,1H3;1H/t9-;/s3 |
| InChIKey | YLESODBCBYZUCT-OVMXBOEKNA-N |
| SMILES | C(OC)(=O)[C@H](CC1CCCCC1)N.[H]Cl |&1:4,r| |
Description and Uses
H-beta-Cyclohexyl-Ala-OMe·HCl is used in the preparation of novel fluoropeptidomimetics, which are potential protease inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| HS Code | 29224999 |
