A5045112
(<I>S</I>)-(+)-2-Phenylglycine methyl ester hydrochloride , 97% , 15028-39-4
CAS NO.：15028-39-4
Empirical Formula: C9H12ClNO2
Molecular Weight: 201.65
MDL number: MFCD00077158
EINECS: 621-423-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB53.60 | In Stock |
|
| 10G | RMB56.00 | In Stock |
|
| 25g | RMB83.20 | In Stock |
|
| 50G | RMB151.20 | In Stock |
|
| 100g | RMB302.40 | In Stock |
|
| 500g | RMB1080.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid |
| color | White to off-white |
| optical activity | [α]20/D +120°, c = 1 in H2O |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C9H11NO2.ClH/c1-12-9(11)8(10)7-5-3-2-4-6-7;/h2-6,8H,10H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | DTHMTBUWTGVEFG-QRPNPIFTSA-N |
| SMILES | [C@@H](C1C=CC=CC=1)(N)C(=O)OC.Cl |
Description and Uses
(S)-(+)-2-Phenylglycine Methyl Ester Hydrochloride can be used to prepare beta-lactam antibiotic ampicillin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280i-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
