A7751312
L-allo-Threonine , 99% , 28954-12-3
Synonym(s):
(2S,3S)-2-Amino-3-hydroxybutyric acid
CAS NO.：28954-12-3
Empirical Formula: C4H9NO3
Molecular Weight: 119.12
MDL number: MFCD00237373
EINECS: 249-327-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB39.20 | In Stock |
|
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB239.20 | In Stock |
|
| 25g | RMB959.20 | In Stock |
|
| 100g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 272 °C (dec.)(lit.) |
| Boiling point: | 222.38°C (rough estimate) |
| alpha | 9 º (c=2, H2O) |
| Density | 1.3126 (rough estimate) |
| refractive index | 10 ° (C=5, H2O) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Water (Slightly) |
| pka | pK1: 2.108(+1);pK2: 9.096(0) (25°C) |
| form | Crystalline Powder |
| color | White to off-white |
| optical activity | [α]23/D +9.0°, c = 2 in H2O |
| BRN | 1721645 |
| InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3-/m0/s1 |
| InChIKey | AYFVYJQAPQTCCC-HRFVKAFMSA-N |
| SMILES | C(O)(=O)[C@H]([C@@H](O)C)N |
| CAS DataBase Reference | 28954-12-3(CAS DataBase Reference) |
Description and Uses
L-allo-Threonine is a reactant used in the synthesis of an antibiotic, globomycin, and its congener, SF-1902 A5.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | BA4055000 |
| HS Code | 29225090 |
