A5046712
Isooctyl mercaptoacetate(mixture of branched chain isomers) , ≥90.0%(T) , 25103-09-7
Synonym(s):
Isooctylthioglycolate;Mercaptoacetic acid isooctyl ester, Isooctyl mercaptoacetate
CAS NO.:25103-09-7
Empirical Formula: C10H20O2S
Molecular Weight: 204.33
MDL number: MFCD00022088
EINECS: 246-613-9
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB96.00 | In Stock |
|
| 100ML | RMB341.60 | In Stock |
|
| 500ml | RMB1279.20 | In Stock |
|
| 2.5L | RMB3199.20 | In Stock |
|
| 10L | RMB6399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-50°C |
| Boiling point: | 96°C |
| Density | 0,97 g/cm3 |
| vapor pressure | 3.1Pa at 20℃ |
| refractive index | 1.4590 to 1.4640 |
| Flash point: | 133°C |
| storage temp. | Store below +30°C. |
| form | liquid |
| Water Solubility | 10.6mg/L at 20℃ |
| Cosmetics Ingredients Functions | HAIR WAVING OR STRAIGHTENING |
| Cosmetic Ingredient Review (CIR) | ISOOCTYL THIOGLYCOLATE (25103-09-7) |
| InChI | InChI=1S/C10H20O2S/c1-9(2)6-4-3-5-7-12-10(11)8-13/h9,13H,3-8H2,1-2H3 |
| InChIKey | RZBBHEJLECUBJT-UHFFFAOYSA-N |
| SMILES | C(=O)(CS)OCCCCCC(C)C |
| LogP | 3.68 at 20℃ |
| CAS DataBase Reference | 25103-09-7(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, mercapto-, isooctyl ester (25103-09-7) |
Description and Uses
Antioxidants, fungicides, oil additives, plasticizers, insecticides, stabilizers, polymerization modifiers, stabilizer in tin-sulfur compounds, stripping agent for polysulfide rubber.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 |
| Risk Statements | 22 |
| Safety Statements | 24 |
| RIDADR | 2810 |
| RTECS | AI7300000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29309090 |
| Hazardous Substances Data | 25103-09-7(Hazardous Substances Data) |
| Toxicity | rabbit,LDLo,oral,1200mg/kg (1200mg/kg),Journal of Economic Entomology. Vol. 48, Pg. 139, 1955. |








![diisooctyl 2,2'-[(dioctylstannylene)bis(thio)]diacetate](https://img.chemicalbook.com/CAS/GIF/26401-97-8.gif)