MR7423556
Analysis standard , 55297-95-5
Synonym(s):
(1S,2R,3S,4S,6R,7S,14R)-6-[(2-Diethylaminoethylthio)acetoxy]-3-hydroxy-2,4,7,14-tetramethyl-4-vinyltricyclo[5,4,3,01.8]tetradecan-9-one
CAS NO.:55297-95-5
Empirical Formula: C28H47NO4S
Molecular Weight: 493.74
MDL number: MFCD01672098
EINECS: 259-580-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB378.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147.5°C |
| Boiling point: | 563.0±50.0 °C(Predicted) |
| Density | 1.0160 (rough estimate) |
| refractive index | 1.6550 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| pka | 14.65±0.70(Predicted) |
| form | Oil |
| color | Colourless |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChIKey | UURAUHCOJAIIRQ-QGLSALSOSA-N |
| SMILES | C(O[C@@H]1C[C@](C=C)(C)[C@@H](O)[C@H](C)[C@@]23CC[C@@H](C)[C@]1(C)[C@]2([H])C(=O)CC3)(=O)CSCCN(CC)CC |
| CAS DataBase Reference | 55297-95-5(CAS DataBase Reference) |
| EPA Substance Registry System | Tiamulin (55297-95-5) |
Description and Uses
Tiamulin is a derivative of Pleuromutilin. Antibacterial.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 2 |
| RTECS | AG9552000 |
| HS Code | 2941906000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 4 |
| Hazardous Substances Data | 55297-95-5(Hazardous Substances Data) |







