BD3852246
Tiamulinfumarate , 98% , 55297-96-6
Synonym(s):
Thiamutilin fumarate
CAS NO.:55297-96-6
Empirical Formula: C32H51NO8S
Molecular Weight: 609.82
MDL number: MFCD00145407
EINECS: 259-581-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB56.00 | In Stock |
|
| 1g | RMB151.20 | In Stock |
|
| 5g | RMB528.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-148°C |
| Boiling point: | 563℃ |
| Flash point: | >110°(230°F) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White |
| Water Solubility | Soluble in water |
| Merck | 13,9495 |
| Major Application | clinical testing |
| InChIKey | YXQXDXAHCSEVSD-IHAONTCTSA-N |
| SMILES | C(/C(=O)O)=C\C(=O)O.C[C@H]1[C@@H]([C@](C[C@@H](OC(=O)CSCCN(CC)CC)C2([C@H](C)CCC31CCC(=O)[C@]32[H])C)(C)C=C)O |&1:9,10,11,13,27,36,r| |
| CAS DataBase Reference | 55297-96-6(CAS DataBase Reference) |
Description and Uses
Tiamulin fumarate is a semisynthetic pleuromutilin antibiotic that binds to the ribosomal peptidyl transferase centre and inhibits protein synthesis. It is a derivative of Pleuromutilin with Antibacterial that targets Gram-positive bacteria as well as a few mycoplasma species.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| RIDADR | UN2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | AG9560000 |
| HS Code | 29419090 |
| Storage Class | 6.1C - Combustible, acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral |







