A7636658
Pleuromutilin , 10mMinDMSO , 125-65-5
Synonym(s):
Drosophilin B;Mutilin 14-glycolate;NSC 121145
CAS NO.:125-65-5
Empirical Formula: C22H34O5
Molecular Weight: 378.5
MDL number: MFCD00864911
EINECS: 204-747-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-1710C |
| Boiling point: | 482.8±45.0 °C(Predicted) |
| alpha | D24 +20° (c = 3 in abs ethanol) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO: >10mg/mL (warmed) |
| pka | 12.91±0.10(Predicted) |
| form | powder |
| color | white to beige |
| optical activity | [α]/D +30 to +40° (c=1; CH2Cl2) |
| InChIKey | YSBXUHAJXRCCET-BKUNHTPHSA-N |
| SMILES | C(O[C@@H]1C[C@](C=C)(C)[C@@H](O)[C@H](C)[C@@]23CC[C@@H](C)[C@]1(C)[C@]2([H])C(=O)CC3)(=O)CO |
Description and Uses
Pleuromutilin is an antibiotic derived from the fungus Clitopilus that inhibits bacterial protein synthesis by binding to bacterial ribosomes in the peptidyl transferase component of the 50S subunit and inhibiting peptide bond formation.
Antibiotic substance produced by the basidiomycetes Pleurotus mutilus.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| WGK Germany | 3 |
| RTECS | MC5408000 |
| Toxicity | LD50 in mice: >60 mg/kg (Kavanagh, 1952) |







