A5047212
(<I>R</I>)-3-(Boc-amino)-2-methylpropionic acid , ≥98.0% , 132696-45-8
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB270.40 | In Stock |
|
| 100mg | RMB595.20 | In Stock |
|
| 250MG | RMB781.60 | In Stock |
|
| 500MG | RMB5519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88 °C (lit.) |
| Boiling point: | 339.5±25.0 °C(Predicted) |
| Density | 1.101±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.53±0.10(Predicted) |
| form | crystals |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D 12±2°, c = 1% in DMF |
| BRN | 7202037 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C9H17NO4/c1-6(7(11)12)5-10-8(13)14-9(2,3)4/h6H,5H2,1-4H3,(H,10,13)(H,11,12)/t6-/m1/s1 |
| InChIKey | GDQRNRYMFXDGMS-ZCFIWIBFSA-N |
| SMILES | C(O)(=O)[C@H](C)CNC(OC(C)(C)C)=O |
Description and Uses
(R)-3-((tertButoxycarbonyl)amino)-2-methylpropanoic Acid has been used as a reactant in the preparation of cryptophycin B and arenastatin A, potent antiumor macrolides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 3-10 |
| Storage Class | 11 - Combustible Solids |






