A5049812
<I>N</I>-Methyl-<SC>L</SC>-alanine , 98% , 3913-67-5
CAS NO.:3913-67-5
Empirical Formula: C4H9NO2
Molecular Weight: 103.12
MDL number: MFCD06801364
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB45.60 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB606.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 315-317 °C (decomp) |
| Boiling point: | 190.1±23.0 °C(Predicted) |
| Density | 1.048±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Slightly), Water (Slightly) |
| form | Solid |
| pka | 2.32±0.10(Predicted) |
| color | White |
| BRN | 1720922 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C4H9NO2/c1-3(5-2)4(6)7/h3,5H,1-2H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | GDFAOVXKHJXLEI-VKHMYHEASA-N |
| SMILES | C(O)(=O)[C@H](C)NC |
| CAS DataBase Reference | 3913-67-5(CAS DataBase Reference) |
| NIST Chemistry Reference | L-alanine, n-methyl-(3913-67-5) |
Description and Uses
N-Methyl-L-alanine is a reactant used in the preparation of site-specific trastuzumab maytansinoid antibody-drug conjugates with improved therapeutic activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |





