A5051912
4-<I>tert</I>-Butyl-2,6-diformylphenol , 96% , 84501-28-0
Synonym(s):
5-(1,1-Dimethylethyl)-2-hydroxy-1,3-benzenedicarboxaldehyde
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB34.40 | In Stock |
|
| 1G | RMB101.60 | In Stock |
|
| 5G | RMB497.60 | In Stock |
|
| 25g | RMB2383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-103 °C(lit.) |
| Boiling point: | 267.8±40.0 °C(Predicted) |
| Density | 1.159±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 6.61±0.23(Predicted) |
| form | powder |
| color | yellow |
| InChI | 1S/C12H14O3/c1-12(2,3)10-4-8(6-13)11(15)9(5-10)7-14/h4-7,15H,1-3H3 |
| InChIKey | WQNTWZJPCLUXQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C=O)c(O)c(C=O)c1 |
Description and Uses
1. Used as a key intermediate for the production of a BODIPY chemodosimetric sensor for cyanide ions. 2. Used as a key intermediate for a Pro-ligand in bimetallic catalysis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2912490090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
