A5053512
(<I>R</I>)-(+)-α−Methyl-1-naphthalenemethanol , 99% , 42177-25-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB1399.20 | In Stock |
|
| 1G | RMB3799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-49 °C(lit.) |
| alpha | 78 º (C=1 IN MEOH) |
| Boiling point: | 316.0±11.0 °C(Predicted) |
| Density | 1.113±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 14.29±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1/C12H12O/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-9,13H,1H3/t9-/s3 |
| InChIKey | CDRQOYRPWJULJN-DJEYLCQNNA-N |
| SMILES | C12C=CC=CC=1C=CC=C2[C@H](O)C |&1:10,r| |
Description and Uses
(R)?-?1-?(Naphthalen-?1-?yl)?ethanol is a coupling reagent used in the synthesis of ferrocene aminophosphoxazoline ligands.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29062990 |
