A5054412
(<i>R</i>,<i>R</i>)-(+)-Hydrobenzoin , ≥99% , 52340-78-0
Synonym(s):
(R,R)-1,2-Diphenyl-1,2-ethanediol;(R,R)-1,2-Diphenylethylene glycol
| Pack Size | Price | Stock | Quantity |
| 1G | RMB114.40 | In Stock |
|
| 5G | RMB301.60 | In Stock |
|
| 25G | RMB1332.00 | In Stock |
|
| 100g | RMB5224.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-149 °C(lit.) |
| Boiling point: | 314.4°C (rough estimate) |
| Density | 1.0781 (rough estimate) |
| refractive index | 95 ° (C=1, CHCl3) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO |
| pka | 13.38±0.20(Predicted) |
| form | Crystalline Powder or Crystals |
| color | White to beige or light brown |
| optical activity | [α]28/D +93°, c = 2.5 in ethanol |
| Merck | 14,4777 |
| BRN | 2050815 |
| InChI | InChI=1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14-/m1/s1 |
| InChIKey | IHPDTPWNFBQHEB-ZIAGYGMSSA-N |
| SMILES | [C@H](C1=CC=CC=C1)(O)[C@@H](C1=CC=CC=C1)O |
| CAS DataBase Reference | 52340-78-0(CAS DataBase Reference) |
Description and Uses
(R,R)-(+)-Hydrobenzoin may be used in the oxyselenenylation step in the multi-step synthesis of cyclopentitols and aminocyclopentitols from cyclopentene. It may also be used as a ligand for the asymmetric addition of diethylzinc to aldehydes in the presence or absence of titanium tetra-isopropoxide to form (R)- or (S)-form of the corresponding secondary alcohol, respectively.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29062990 |
