A5062112
3-Iodo-6-nitroindazole , ≥98% , 70315-70-7
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB40.00 | In Stock |
|
| 250mg | RMB68.80 | In Stock |
|
| 1G | RMB174.40 | In Stock |
|
| 5g | RMB3015.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 259-261 °C |
| Boiling point: | 458.0±25.0 °C(Predicted) |
| Density | 2.24 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 9.12±0.40(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C7H4IN3O2/c8-7-5-2-1-4(11(12)13)3-6(5)9-10-7/h1-3H,(H,9,10) |
| InChIKey | GZCGNGLOCQEDMT-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC([N+]([O-])=O)=C2)C(I)=N1 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 22-60 |
| Safety Statements | 53-22-36/37/39-45 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





