A5065912
(<i>E</i>)-5-(2-Bromovinyl)-2'-deoxyuridine , ≥98.0%(HPLC) , 69304-47-8
Synonym(s):
BVdU
CAS NO.:69304-47-8
Empirical Formula: C11H13BrN2O5
Molecular Weight: 333.14
MDL number: MFCD00058585
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB79.20 | In Stock |
|
| 250MG | RMB279.20 | In Stock |
|
| 1G | RMB759.20 | In Stock |
|
| 5g | RMB2663.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165°C |
| Density | 1.7800 (rough estimate) |
| refractive index | 1.6520 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.37±0.10(Predicted) |
| color | Off-White |
| Water Solubility | Soluble in water and methanol. |
| Merck | 14,1378 |
| InChI | 1S/C11H13BrN2O5/c12-2-1-6-4-14(11(18)13-10(6)17)9-3-7(16)8(5-15)19-9/h1-2,4,7-9,15-16H,3,5H2,(H,13,17,18)/b2-1+/t7-,8+,9+/m0/s1 |
| InChIKey | ODZBBRURCPAEIQ-CXYVBZRVSA-N |
| SMILES | O=C(C(/C=C/Br)=CN1[C@H]2C[C@H](O)[C@@H](CO)O2)NC1=O |
Description and Uses
(E)-5-(2-Bromovinyl)-2'-deoxyuridine is an thymidine analogue and acts as an anti-viral by inhibiting DNA plymerase.
Brivudine is a nucloside analog which causes induction of neuronal differentiation in human reporter cell lines and adult stem cells. Anti-Herpes medication.
Safety
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | YU7355000 |
| HS Code | 29349990 |






