A5067012
2'-Iodoacetophenone , >98.0%(GC) , 2142-70-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB96.80 | In Stock |
|
| 25G | RMB371.20 | In Stock |
|
| 100G | RMB1263.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 139-140°C 12mm |
| Density | 1.72 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 218 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.720 |
| color | Clear yellow |
| Sensitive | Light Sensitive |
| BRN | 2325078 |
| InChI | InChI=1S/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| InChIKey | XDXCBCXNCQGZPG-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1I)C |
| CAS DataBase Reference | 2142-70-3(CAS DataBase Reference) |
Description and Uses
2′-Iodoacetophenone (2-Iodoacetophenone) may be used in the synthesis of:
indene derivatives
di-(o-acetylphenyl)acetylene
indenol derivative
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P280a-P305+P351+P338-P321-P332+P313-P337+P313-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | C |
| Risk Statements | 36/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
