A5072412
Imipramine Hydrochloride , >98.0%(HPLC) , 113-52-0
Synonym(s):
10,11-Dihydro-N,N-dimethyl-5H-dibenz[b,f]azepine-5-propanamine hydrochloride;5-[3-(Dimethylamino)propyl]-10,11-dihydro-5H-dibenz[b,f]azepine hydrochloride;IMI;Imipramine hydrochloride
CAS NO.:113-52-0
Empirical Formula: C19H25ClN2
Molecular Weight: 316.87
MDL number: MFCD00012669
EINECS: 204-030-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB84.00 | In Stock |
|
| 1G | RMB236.80 | In Stock |
|
| 5G | RMB383.20 | In Stock |
|
| 25G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-1700C |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL |
| form | crystalline |
| color | white |
| PH | 4.2~5.2(100g/l,25℃) |
| Water Solubility | Soluble in water |
| λmax | 260nm(lit.) |
| Merck | 14,4920 |
| InChI | 1S/C19H24N2.ClH/c1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21;/h3-6,8-11H,7,12-15H2,1-2H3;1H |
| InChIKey | XZZXIYZZBJDEEP-UHFFFAOYSA-N |
| SMILES | Cl[H].CN(C)CCCN1c2ccccc2CCc3ccccc13 |
| CAS DataBase Reference | 113-52-0(CAS DataBase Reference) |
| EPA Substance Registry System | 5H-Dibenz[b,f]azepine-5-propanamine, 10,11-dihydro-N,N-dimethyl-, monohydrochloride (113-52-0) |
Description and Uses
Imipramine hydrochloride is used as a serotonin uptake inhibitor. It mainly used in the treatment of major depression and enuresis (inability to control urination). It has also been evaluated for use in panic disorder.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | Xn,T,F |
| Risk Statements | 23/25-36/38-36/37/38-22-39/23/24/25-23/24/25-11 |
| Safety Statements | 7-16-24-33-45-36-26-36/37 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 3 |
| RTECS | HO1925000 |
| TSCA | TSCA listed |
| HS Code | 2933995800 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |
| Toxicity | LD50 in mice, rats (mg/kg): 400, 490 orally; 110, 90 i.p. (Tobe) |






