Diphenhydramine Hydrochloride , ≥98%(HPLC) , 147-24-0
Synonym(s):
N-(2-Diphenylmethoxyethyl)-N,N-dimethylamine hydrochloride;2-Diphenylmethoxy-N,N-dimethylethylamine hydrochloride;DP;DPH
CAS NO.:147-24-0
Empirical Formula: C17H22ClNO
Molecular Weight: 291.82
MDL number: MFCD00012479
EINECS: 205-687-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB84.00 | In Stock |
|
| 100G | RMB297.60 | In Stock |
|
| 500G | RMB860.80 | In Stock |
|
| 2.5kg | RMB3012.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 168-172 °C |
| Boiling point: | 163-167 °C(Press: 3 Torr) |
| Density | 1.0489 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | Very soluble in water, freely soluble in alcohol. |
| form | Crystalline Powder or Adhering Crystals |
| color | White |
| PH | pH(100g/L, 25℃) 4.0~5.5 |
| Water Solubility | 1000 g/L |
| Sensitive | Light Sensitive |
| Merck | 14,3309 |
| Stability: | Stable, but slowly darkens upon exposure to light. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | HAIR CONDITIONING SKIN CONDITIONING |
| InChI | 1S/C17H21NO.ClH/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,17H,13-14H2,1-2H3;1H |
| InChIKey | PCHPORCSPXIHLZ-UHFFFAOYSA-N |
| SMILES | Cl[H].CN(C)CCOC(c1ccccc1)c2ccccc2 |
| LogP | 3.662 (est) |
| CAS DataBase Reference | 147-24-0(CAS DataBase Reference) |
| NIST Chemistry Reference | diphenhydramine hydrochloride(147-24-0) |
| EPA Substance Registry System | Diphenhydramine hydrochloride (147-24-0) |
Description and Uses
Diphenhydramine is most commonly used as a first-generation antihistamine and is globally marketed in various brand formulations (Benadryl®, Unisom®, Tylenol®, Zzzquil®). It competitively blocks H1 receptors, thereby preventing the actions of histamine on bronchial smooth muscle, capillaries, and gastrointestinal (GI) smooth muscle. This prevents histamine-induced bronchoconstriction, vasodilation, increased capillary permeability, and GI smooth muscle spasms. Diphenhydramine exhibits anti-tussive, antiemetic, sedative, anti-allergic, and anticholinergic activities.
Diphenhydramine is a H1-histamine receptor antagonist with anticholinergic (drying) and sedative side effects. It is categorized as an antihistaminic; sedative, hypnotic, treatment of allergic. It is used to treat allergy and cold symptoms such as sneezing, runny nose, watery eyes, urticaria (hives), skin rash, and pruritus (itchy skin).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-39/23/24/25-23/24/25-11 |
| Safety Statements | 36-45-36/37-16-7-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | KR7000000 |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 orally in rats: 500 mg/kg (Gruhzit, Fisken) |





