A7762158
Orphenadrinehydrochloride , 10mMinDMSO , 341-69-5
Synonym(s):
β-Dimethylaminoethyl 2-methylbenzhydryl ether hydrochloride;N,N-Dimethyl-2-(2-methylbenzhydryloxy)ethylamine hydrochloride;o-Methyldiphenhydramine hydrochloride
CAS NO.:341-69-5
Empirical Formula: C18H24ClNO
Molecular Weight: 305.84
MDL number: MFCD00012480
EINECS: 206-435-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159.0 to 164.0 °C |
| Boiling point: | -195 °C |
| Density | 0.295 g/cm3 |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water and in ethanol (96 per cent). |
| form | powder |
| color | Crystals |
| BRN | 3745818 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C18H23NO.ClH/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16;/h4-12,18H,13-14H2,1-3H3;1H |
| InChIKey | UQZKYYIKWZOKKD-UHFFFAOYSA-N |
| SMILES | Cl.CN(C)CCOC(c1ccccc1)c2ccccc2C |
| CAS DataBase Reference | 341-69-5(CAS DataBase Reference) |
| EPA Substance Registry System | Orphenadrine hydrochloride (341-69-5) |
Description and Uses
Antihistaminic;H1 antogonist
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | KR6300000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 oral in rat: 255mg/kg |







